Iocarmic acid: Difference between revisions

{{Short description|Chemical compound}}

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 407427669

| IUPAC_name = 3-(5-<nowiki/>{[3-carboxy-2,4,6-triiodo-5-(methylcarbamoyl)phenyl]carbamoyl}pentanamido)-2,4,6-triiodo-5-(methylcarbamoyl)benzoic acid

| image = Iocarmic acid.png

| alt = Skeletal formula of iocarmic acid

| width = 260

| image2 = Iocarmic-acid-3D-spacefill.png

| alt2 = Space-filling model of the iocarmic acid molecule

<!--Clinical data-->

| tradename = Dimer-X

| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->

| pregnancy_US = <!-- A / B / C / D / X -->

| pregnancy_category =

| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->

| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->

| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->

| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->

| legal_status =

<!--Pharmacokinetic data-->

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

<!--Identifiers-->

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 10397-75-8

| ATC_prefix = V08

| ATC_suffix = AA08

| PubChem = 25229

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB13755

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = 82PB24K6TZ

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D01099

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 23564

<!--Chemical data-->

| C=24 | H=20 | I=6 | N=4 | O=8

| synonyms = <small>3-<nowiki/>{{bracket|[6-[{{bracket|3-Carboxy-2,4,6-triiodo-5-(methylcarbamoyl)phenyl]amino}}-6-oxohexanoyl]amino}}-2,4,6-triiodo-5-(methylcarbamoyl)benzoic acid </small>

| smiles = CNC(=O)c1c(c(c(c(c1I)NC(=O)CCCCC(=O)Nc2c(c(c(c(c2I)C(=O)O)I)C(=O)NC)I)I)C(=O)O)I

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C24H20I6N4O8/c1-31-21(37)9-13(25)11(23(39)40)17(29)19(15(9)27)33-7(35)5-3-4-6-8(36)34-20-16(28)10(22(38)32-2)14(26)12(18(20)30)24(41)42/h3-6H2,1-2H3,(H,31,37)(H,32,38)(H,33,35)(H,34,36)(H,39,40)(H,41,42)

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = SMQYOVYWPWASGU-UHFFFAOYSA-N

'''Iocarmic acid''' (trade name '''Dimer-X''') is a pharmaceutical drug used as an [[iodinated contrast]] medium for X-ray imaging in the 1970s and 80s. Uses included imaging of the [[uterus]] and [[fallopian tube]]s. It was applied in form of its salt, [[meglumine]] iocarmate.<ref>{{cite journal | vauthors = Schütte HE | title = Comparative study: Endografine (diatrizoate), Vasurix polyvidone (acetrizoate), Dimer-X (iocarmate) and Hexabrix (ioxaglate) in hysterosalpingography | journal = Diagnostic Imaging | volume = 51 | issue = 6 | pages = 277–83 | year = 1982 | pmid = 7173007 }}</ref><ref>{{cite journal | vauthors = Van Dellen JR, Lipschitz R | title = Meglumine iocarmate (Dimer-X) ventriculography | journal = Clinical Radiology | volume = 24 | issue = 4 | pages = 449–52 | date = October 1973 | pmid = 4621055 | doi = 10.1016/s0009-9260(73)80146-1 }}</ref>

It is not known to be marketed anywhere in the world in 2021.

== References ==

{{reflist}}

[[Category:Iodobenzene derivatives]]

{{pharmacology-stub}}