Ecgonine: Difference between revisions
Appearance
Content deleted Content added
Updating {{chembox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[Wikipedia:WikiProject Chemicals/Chem |
No edit summary |
||
(53 intermediate revisions by 35 users not shown) | |||
Line 1: | Line 1: | ||
{{chembox |
{{chembox |
||
| Verifiedfields = changed |
|||
⚫ | |||
| Watchedfields = changed |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
<!-- | ImageSize = 200px --> |
|||
⚫ | |||
⚫ | |||
| ImageFile1 = Ecgonine-3D-balls.png |
|||
⚫ | |||
<!-- | ImageSize1 = 200px --> |
|||
| ImageName1 = Ball-and-stick model of the ecgonine molecule |
| ImageFile1 = Ecgonine-3D-balls.png |
||
| ImageName1 = Ball-and-stick model of the ecgonine molecule |
|||
| IUPACName = 3β-Hydroxytropane-2β-carboxylic acid |
|||
| IUPACName = (1''R'',2''R'',3''S'',5''S'')-3-hydroxy-8-methyl-8-azabicyclo |
|||
[3.2.1]octane-2-carboxylic acid |
| SystematicName = (1''R'',2''R'',3''S'',5''S'')-3-Hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylic acid |
||
| |
|Section1={{Chembox Identifiers |
||
| CASNo_Ref = {{cascite|correct|CAS}} |
|||
| |
| CASNo = 481-37-8 |
||
| |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
||
| DrugBank = DB01525 |
| DrugBank = DB01525 |
||
| PubChem = 91460 |
|||
| SMILES = CN2C1CCC2CC(O)C1C(O)=O |
|||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|||
⚫ | |||
| ChemSpiderID = 82586 |
|||
⚫ | |||
| EC_number = 207-565-4 |
|||
| Formula = C<sub>9</sub>H<sub>15</sub>NO<sub>3</sub> |
|||
| ChEBI = 4743 |
|||
| MolarMass = 185.2203 g·mol<sup>−1</sup> |
|||
| ChEMBL = 612017 |
|||
⚫ | |||
| 3DMet = B05731 |
|||
| MeltingPt = 198–199 °C |
|||
| KEGG = C10858 |
|||
⚫ | |||
| SMILES = O=C(O)[C@H]1[C@@H](O)C[C@H]2N(C)[C@@H]1CC2 |
|||
| legal_status = Schedule II (US), Class A (UK) |
|||
| InChI = 1/C9H15NO3/c1-10-5-2-3-6(10)8(9(12)13)7(11)4-5/h5-8,11H,2-4H2,1H3,(H,12,13)/t5-,6+,7-,8+/m0/s1 |
|||
| InChIKey = PHMBVCPLDPDESM-FKSUSPILBM |
|||
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|||
| StdInChI = 1S/C9H15NO3/c1-10-5-2-3-6(10)8(9(12)13)7(11)4-5/h5-8,11H,2-4H2,1H3,(H,12,13)/t5-,6+,7-,8+/m0/s1 |
|||
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|||
| StdInChIKey = PHMBVCPLDPDESM-FKSUSPILSA-N |
|||
| UNII_Ref = {{fdacite|changed|FDA}} |
|||
| UNII = DX2E9E17AV |
|||
}} |
}} |
||
⚫ | |||
| C=9 | H=15 | N=1 | O=3 |
|||
⚫ | |||
| MeltingPtC = 198 to 199 |
|||
| MeltingPt_notes = (hydrate) |
|||
⚫ | |||
⚫ | |||
|Section3={{Chembox Pharmacology |
|||
| Legal_BR = F1 |
|||
| Legal_CA = Schedule I |
|||
| Legal_US = Schedule II |
|||
| Legal_AU = Schedule 9 |
|||
| Legal_UK = CD |
|||
}} |
|||
}} |
}} |
||
'''Ecgonine''' |
'''Ecgonine''' ([[tropane]] derivative) is a [[tropane alkaloid]] found naturally in [[coca]] leaves. It has a close structural relation to [[cocaine]]: it is both a [[metabolite]] and a [[Precursor (chemistry)|precursor]], and as such, it is a [[controlled substance]] in many jurisdictions, as are some substances which can be used as precursors to ecgonine itself. |
||
Structurally, ecgonine is a [[cycloheptane]] derivative with a [[ |
Structurally, ecgonine is a [[cycloheptane]] derivative with a nitrogen [[bridge (chemical)|bridge]]. It is obtained by [[hydrolysis]] of [[cocaine]] with acids or [[alkali]]s, and crystallizes with one molecule of water, the crystals melting at 198–199 °C. It is [[levorotary]], and on warming with alkalis gives iso-ecgonine, which is [[dextrorotary]].{{sfn|Chisholm|1911}} |
||
It is a tertiary [[Lewis base|base]], and has the properties of an acid and an alcohol. It is the [[carboxylic acid]] corresponding to [[tropine]], for it yields the same products on oxidation, and by treatment with [[phosphorus pentachloride]] is converted into [[anhydroecgonine]], C<sub>9</sub>H<sub>13</sub>NO<sub>2</sub>, which, when heated to 280 °C with [[hydrochloric acid]], eliminates [[carbon dioxide]] and yields [[tropidine]], C<sub>8</sub>H<sub>13</sub>N. |
It is a tertiary [[Lewis base|base]], and has the properties of an acid and an alcohol. It is the [[carboxylic acid]] corresponding to [[tropine]], for it yields the same products on oxidation, and by treatment with [[phosphorus pentachloride]] is converted into [[anhydroecgonine]], C<sub>9</sub>H<sub>13</sub>NO<sub>2</sub>, which, when heated to 280 °C with [[hydrochloric acid]], eliminates [[carbon dioxide]] and yields [[tropidine]], C<sub>8</sub>H<sub>13</sub>N.{{sfn|Chisholm|1911}} |
||
==See also== |
== See also == |
||
*[[ |
* [[Coca alkaloid]]s |
||
*[[ |
* [[Anhydroecgonine]] |
||
*[[Cocaethylene]] |
* [[Cocaethylene]] |
||
⚫ | |||
*[[Cocaine]] |
|||
*[[ |
* [[Methylecgonidine]] |
||
⚫ | |||
⚫ | |||
⚫ | |||
*[[Hydroxytropacocaine]] |
|||
*[[ |
* [[Troparil]] |
||
*[[Methylecgonidine]] |
|||
⚫ | |||
⚫ | |||
*[[Truxilline]] |
|||
*[[Tropacocaine]] |
|||
*[[Troparil]] |
|||
==References== |
== References == |
||
{{Citation style|date=September 2007}} |
|||
<references/> |
<references/> |
||
*{{EB1911|wstitle=Ecgonine|volume=8|page=870}} |
|||
*{{1911}} |
|||
⚫ | |||
⚫ | |||
[[Category:Natural tropane alkaloids]] |
|||
⚫ | |||
[[de:Ecgonin]] |
|||
[[Category:Tropane alkaloids found in Erythroxylum coca]] |
|||
[[es:Ecgonina]] |
|||
⚫ | |||
[[fr:Ecgonine]] |
|||
[[Category:Human drug metabolites]] |
|||
[[it:Ecgonina]] |
|||
[[ru:Экгонин]] |
|||
[[fi:Ekgoniini]] |
|||
[[sv:Ekgonin]] |