Jump to content

Ecgonine: Difference between revisions

Page 1
Page 2
Content deleted Content added
CheMoBot (talk | contribs)
Updating {{chembox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[Wikipedia:WikiProject Chemicals/Chem
No edit summary
 
(53 intermediate revisions by 35 users not shown)
Line 1: Line 1:
{{chembox
{{chembox
| Verifiedfields = changed
| verifiedrevid = 443718052
| Watchedfields = changed
| Name = Ecgonine
| verifiedrevid = 443719655
| ImageFile = Ecgonin - Ecgonine.svg
| Name = Ecgonine
<!-- | ImageSize = 200px -->
| ImageFile = Ecgonin - Ecgonine.svg
| ImageName = Semi-skeletal formula of ecgonine

| ImageFile1 = Ecgonine-3D-balls.png
| ImageName = Semi-skeletal formula of ecgonine
<!-- | ImageSize1 = 200px -->
| ImageName1 = Ball-and-stick model of the ecgonine molecule
| ImageFile1 = Ecgonine-3D-balls.png
| ImageName1 = Ball-and-stick model of the ecgonine molecule
| IUPACName = 3β-Hydroxytropane-2β-carboxylic acid
| IUPACName = (1''R'',2''R'',3''S'',5''S'')-3-hydroxy-8-methyl-8-azabicyclo
[3.2.1]octane-2-carboxylic acid
| SystematicName = (1''R'',2''R'',3''S'',5''S'')-3-Hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylic acid
| Section1 = {{Chembox Identifiers
|Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 481-37-8
| CASNo = 481-37-8
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01525
| DrugBank = DB01525
| PubChem = 91460
| SMILES = CN2C1CCC2CC(O)C1C(O)=O
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
}}
| ChemSpiderID = 82586
| Section2 = {{Chembox Properties
| EC_number = 207-565-4
| Formula = C<sub>9</sub>H<sub>15</sub>NO<sub>3</sub>
| ChEBI = 4743
| MolarMass = 185.2203&nbsp;g&middot;mol<sup>&minus;1</sup>
| ChEMBL = 612017
| Density = 1.293&nbsp;±&nbsp;0.06&nbsp;g&middot;cm<sup>&minus;3</sup>
| 3DMet = B05731
| MeltingPt = 198&ndash;199&nbsp;°C
| KEGG = C10858
| BoilingPt =
| SMILES = O=C(O)[C@H]1[C@@H](O)C[C@H]2N(C)[C@@H]1CC2
| legal_status = Schedule II (US), Class A (UK)
| InChI = 1/C9H15NO3/c1-10-5-2-3-6(10)8(9(12)13)7(11)4-5/h5-8,11H,2-4H2,1H3,(H,12,13)/t5-,6+,7-,8+/m0/s1
| InChIKey = PHMBVCPLDPDESM-FKSUSPILBM
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C9H15NO3/c1-10-5-2-3-6(10)8(9(12)13)7(11)4-5/h5-8,11H,2-4H2,1H3,(H,12,13)/t5-,6+,7-,8+/m0/s1
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = PHMBVCPLDPDESM-FKSUSPILSA-N
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII = DX2E9E17AV
}}
}}
|Section2={{Chembox Properties
| C=9 | H=15 | N=1 | O=3
| Density = 1.293±0.06&nbsp;g/cm<sup>3</sup>
| MeltingPtC = 198 to 199
| MeltingPt_notes = (hydrate)
| BoilingPt =
}}
|Section3={{Chembox Pharmacology
| Legal_BR = F1
| Legal_CA = Schedule I
| Legal_US = Schedule II
| Legal_AU = Schedule 9
| Legal_UK = CD
}}
}}
}}


'''Ecgonine''' is an [[organic chemical]] and [[tropane alkaloid]] found naturally in [[coca]] leaves. It has a close structural relation to [[cocaine]]: it is both a [[metabolite]] and a [[wiktionary:Precursor|precursor]], and as such, it is a [[controlled substance]], as are all known substances which can be used as precursors to ecgonine itself.
'''Ecgonine''' ([[tropane]] derivative) is a [[tropane alkaloid]] found naturally in [[coca]] leaves. It has a close structural relation to [[cocaine]]: it is both a [[metabolite]] and a [[Precursor (chemistry)|precursor]], and as such, it is a [[controlled substance]] in many jurisdictions, as are some substances which can be used as precursors to ecgonine itself.


Structurally, ecgonine is a [[cycloheptane]] derivative with a [[nitrogen bridge]]. It is obtained by [[hydrolysis]] of [[cocaine]] with acids or [[alkali]]s, and crystallizes with one molecule of water, the crystals melting at 198&ndash;199&nbsp;°C. It is [[levorotary]], and on warming with alkalis gives iso-ecgonine, which is [[dextrorotary]].
Structurally, ecgonine is a [[cycloheptane]] derivative with a nitrogen [[bridge (chemical)|bridge]]. It is obtained by [[hydrolysis]] of [[cocaine]] with acids or [[alkali]]s, and crystallizes with one molecule of water, the crystals melting at 198–199&nbsp;°C. It is [[levorotary]], and on warming with alkalis gives iso-ecgonine, which is [[dextrorotary]].{{sfn|Chisholm|1911}}


It is a tertiary [[Lewis base|base]], and has the properties of an acid and an alcohol. It is the [[carboxylic acid]] corresponding to [[tropine]], for it yields the same products on oxidation, and by treatment with [[phosphorus pentachloride]] is converted into [[anhydroecgonine]], C<sub>9</sub>H<sub>13</sub>NO<sub>2</sub>, which, when heated to 280&nbsp;°C with [[hydrochloric acid]], eliminates [[carbon dioxide]] and yields [[tropidine]], C<sub>8</sub>H<sub>13</sub>N.
It is a tertiary [[Lewis base|base]], and has the properties of an acid and an alcohol. It is the [[carboxylic acid]] corresponding to [[tropine]], for it yields the same products on oxidation, and by treatment with [[phosphorus pentachloride]] is converted into [[anhydroecgonine]], C<sub>9</sub>H<sub>13</sub>NO<sub>2</sub>, which, when heated to 280&nbsp;°C with [[hydrochloric acid]], eliminates [[carbon dioxide]] and yields [[tropidine]], C<sub>8</sub>H<sub>13</sub>N.{{sfn|Chisholm|1911}}


==See also==
== See also ==
*[[Anhydroecgonine]]
* [[Coca alkaloid]]s
*[[Benzoylecgonine]]
* [[Anhydroecgonine]]
*[[Cocaethylene]]
* [[Cocaethylene]]
* [[Dihydrocuscohygrine]]
*[[Cocaine]]
*[[Cuscohygrine]]
* [[Methylecgonidine]]
* [[Salicylmethylecgonine]]
*[[Dihydrocuscohygrine]]
* [[Tropinone]]
*[[Hydroxytropacocaine]]
*[[Hygrine]]
* [[Troparil]]
*[[Methylecgonidine]]
*[[Salicylmethylecgonine]]
*[[Tropinone]]
*[[Truxilline]]
*[[Tropacocaine]]
*[[Troparil]]


==References==
== References ==
{{Citation style|date=September 2007}}
<references/>
<references/>
*{{EB1911|wstitle=Ecgonine|volume=8|page=870}}
*{{1911}}

[[Category:Alcohols]]
[[Category:Carboxylic acids]]
[[Category:Natural tropane alkaloids]]


[[Category:Beta-Amino acids]]
[[de:Ecgonin]]
[[Category:Tropane alkaloids found in Erythroxylum coca]]
[[es:Ecgonina]]
[[Category:Secondary alcohols]]
[[fr:Ecgonine]]
[[Category:Human drug metabolites]]
[[it:Ecgonina]]
[[ru:Экгонин]]
[[fi:Ekgoniini]]
[[sv:Ekgonin]]