The document consists of various assignments for a Class +2 chemistry course focusing on IUPAC nomenclature, chemical reactions, reasoning questions, and distinguishing compounds. It includes tasks such as naming compounds, drawing structures, predicting reaction products, and explaining chemical properties and reactions. Additionally, it presents special questions involving organic compounds and their transformations.
The document consists of various assignments for a Class +2 chemistry course focusing on IUPAC nomenclature, chemical reactions, reasoning questions, and distinguishing compounds. It includes tasks such as naming compounds, drawing structures, predicting reaction products, and explaining chemical properties and reactions. Additionally, it presents special questions involving organic compounds and their transformations.
The document consists of various assignments for a Class +2 chemistry course focusing on IUPAC nomenclature, chemical reactions, reasoning questions, and distinguishing compounds. It includes tasks such as naming compounds, drawing structures, predicting reaction products, and explaining chemical properties and reactions. Additionally, it presents special questions involving organic compounds and their transformations.
The document consists of various assignments for a Class +2 chemistry course focusing on IUPAC nomenclature, chemical reactions, reasoning questions, and distinguishing compounds. It includes tasks such as naming compounds, drawing structures, predicting reaction products, and explaining chemical properties and reactions. Additionally, it presents special questions involving organic compounds and their transformations.
Download as DOCX, PDF, TXT or read online from Scribd
Download as docx, pdf, or txt
You are on page 1/ 6
Assignment
IUPAC based Questions
Class + 2
1. Name the following compounds according to IUPAC system of nomenclature:
(i) CH3CH(CH3)CH2CH2CHO (ii) CH3CH2COCH(C2H5)CH2CH2CI (iii) CH3CH=CHCHO (iv) CH3COCH2COCH3 (v) CH3CH(CH3)CH2C(CH3)2COCH3 (vi) (CH3)3CCH2COOH (vii) OHC—C6H4 —CHO- p 2. Draw the structures of the following compounds: (i) 3 -Methylbutanal (ii) p-Nitropropiophenone (iii) p-Methylbenzaldehyde (iv) 4-Methylpent-3-en-2-one (v) 4-Chloropentan-2-one (vi) 3-Bromo-4-phenylpentanoic acid (vii) p, p'-Dihydroxybenzophenone (viii) Hex-2-en-4-ynoic acid 3. Write the structures of the following compounds: (i) -Methoxypropionaldehyde (ii) 3-Hydroxybutanal (iii) 2-Hydroxy cyclopentane carbaldehyde (iv) 4-Oxopentanal (v) Di-sec-butyl ketone (vi) 4-Fluoroacetophenonl --------------- Assignment Complete the reactions Class + 2 1. Write the structures of the products of the following reactions:
2. Predict the products of the following reactions:
3. Complete each synthesis by giving missing starting, reagents or products:
---------------------------- Assignment Reasoning Questions Class + 2 1. Arrange the following compounds in increasing order of their property as indicated: (i) Acetaldehyde, Acetone, Di-tert-butyl ketone, Methyl tert-butyl ketone (reactivity towards HCN). (ii) CH3CH2CH(Br)COOH, CH3CH(Br)CH2COOH, (CH3)2CHCOOH,CH3CH2CH2COOH (acid strength). (iii) Benzoic acid, 4-Nitrobenzoic acid, 3,4-Dinitrobenzoic acid, 4-Methoxy benzoic acid (acid strength). 2. Which acid of each pair shown here would you expect to be stronger? (i) CH3CO2H or CH2FCO2H (ii) CH2FCO2H or CH2CICO2H (iii) CH2FCH2CH2CO2 or CH3CHFCH2COOH
(iv) 3. Arrange the following compounds in increasing order of their boiling points: CH3CHO, CH3CH2OH, CH3OCH3, CH3CH2CH3 4. Arrange the following compounds in increasing order of their reactivity in nucleophilic addition reactions (i) Ethanal, Propanal, Propanone, Butanone (ii) Benzaldchyde, p-Tolualdehyde, p-Nitrobenzaidehyde, Acetophenone 5. Would you expect benzaldehyde to be more reactive or less reactive in nucleophilic addition reactions than propanal? Explain your answer. 6. Arrange the following in order of increasing acidity: (i) HCOOH, ClCH2COOH, CH3COOH (ii) CH3COOH, (CH3)2CHCOOH, (CH3)3CCOOH (iii) CICH2COOH, Cl2CHCOOH,Cl3CCOOH (iv) ClCH2COOH, CH3CH2COOH, ClCH2CH2COOH, (CH3)2 CHCOOH, CH3COOH (v) CH3COOH, Cl2CHCOOH, CH3CH2COOH, Cl3CCOOH, ClCH2COOH (vi) HClO, HClO2, HClO3, HClO4 7. Accounts for the following: (i) Carboxylic acids with five or fewer carbon atoms are water soluble butt, higher are insoluble. (ii) Highly branched carboxylic acids are less acidic than unbranched acids. (iii) Acetic acid can be halogenated in presence of phosphorus and chlorine but formic acid cannot be halogenated in the same way. (iv) mathCarbon-oxygen bond lengths in formic acid are 1.23 Å and 1.36 Å but in sodium formate both carbon-oxygen bonds have same value i.e, 1.27 Å. (v) Formic acid is stronger than acetic acid. 8. Account for the following: (a) Roiling points of carboxylic acids are higher than those of corresponding aldehydes and ketones. (b) The C - O bond in R - COOH is shorter than in R - OH. (c) Acetic acid in the vapour state has a molecular mass of 120. 9. Although phenoxide ion has more number of resonating structures than carboxylate ion, carboxylic acid is a stronger acid than phenol. Why? ------------------------ Assignment Chemical Reactions based questions Class + 2
1. Write chemical reactions to affect the following transformations
(i) Butan-l-ol to butanoic acid (ii) Benzyl alcohol to phenyl ethanoic acid (iii) 3-Nitrobromobenzene to 3-nitrobenzoic acid (iv) 4-Methyl acetophenone to benzene-1,4- dicarboxylic acid. (v) Cyclohexene to hexane-1,6-dioic acid (vi) Butanal to butanoic acid. 2. Give names of the reagents to bring about the following transformations (i) Hexan-l-ol to hexanal (ii) Cyclohexanol to cyclohexanone (iii) p-Fluorotoluene to p-fluorobenzaldehyde (iv) Ethanenitrile to ethanal (v) Allyl alcohol to propenal (vi) But-2-ene to ethanal. 3. Show how each of the following compounds can be converted to benzoic acid. (i )Ethylbenzene (ii) Acetophenone (iii) Bromobenzene (iv) Phenylethene (styrene) 4. What is meant by the following terms? Give an example of the reaction in each case. (i) Cyanohydrin (ii) Acetal (iii) Semicarbazone (iv) Aldol (v) Hemiacetal (vi) Oxime (vii) Ketal (viii) Imine (ix) 2.4-DNP-derivative (x) Schiff's base 5. Which of the following compounds would undergo aldol condensation, which is the Cannizzaro reaction and which neither? Write the structures of the expected products of aldol condensation and Cannizzaro reaction. (i) Methanal (ii) 2-Methylpentanal (iii) Benzaldehyde (iv) Benzophenone (v) Cyclohexanone (vi) l-Phenylpropanone (vii) Phenylacetaldehyde (viii) Butan-l-0l (ix) 2,2-Dimethylbutanal 6. How will you convert ethanol into the following compounds? (I ) Butane-1, -3-diol (II) But-2-enal (III) But-2-enoic acid 7. Write structure formulae and names of four possible aldol condensation products from propanal and butanal. In each case, indicate which aldehyde acts as nucleophile and which as electrophile? 8. Describe the following: (i) Acetylation (ii) Cannizzaro reaction (iii) Cross aldol condensation (iv) Decarboxylation 9. How will you prepare the following compounds from benzene? You may use any inorganic reagent and any organic reagent having not more than one carbon atom. (i) Methyl benzoate (ii) m-Nitrobenzoic acid (iii) p-Nitrobenzoic acid (iv) Phenlacetic acid (v) P-Nitrobenzaldehyde ------------ Assignment Distinctions Class + 2
1. Give simple chemical tests to distinguish between the following pairs of compounds: (i) Propanal and propanone (ii) Acetophenone and benzophenone (iii) Phenol and benzoic acid (iv) Benzoic acid and ethyl benzoate (v) Pentan-2-one and pentan-3-one (vi) Benzaldehyde and acetophenone (vii) Ethanal and propanal. 2. How will you bring about the following conversions in not more than two steps? (i) Propanone to propene (ii) Benzoic acid to benzaldehyde (iii) Ethanol to 3-hydroxybutanal (iv) Benzene to m-nitroacetophenone (v) Benzaldehyde to benzophenone (vi) Bromo benzene to l-phenylethanol (vii) Benzaldehyde to 3-phenylpropan-l-ol (viii) Benzaldehyde to -hydroxyphenylacetic acid (ix) Benzoic acid to m-nitrobenzyl alcohol ----------------- Assignment Some special questions Class + 2
1. An organic compound 'A' (M.F. C8H16O2) was hydrolysed with dilute H2SO4 to give a carboxylic acid 'B' and an alcohol 'C'. Oxidation of 'C' with chromic acid produced 'B'. 'C' on dehydration gives but-l- ene. Write equations for the reactions involved. 2. An organic compound with the molecular formula, C 9H10O forms 2,4-DNP derivative, reduces Tollens reagent and undergoes Cannizzaro reaction. On vigorous oxidation, it gives 1, 2-benzene dicarboxylic acid. Identify the compound. -------------------------
