Izvorni kod stranice Tedatioksetin

{{Drugbox-lat
| verifiedrevid = 454958463
| IUPAC_name = 4-<nowiki>{</nowiki>2-[(4-metilfenil)sulfanil]fenil}}piperidin
| image = Tedatioxetine.svg
| width =
| image2 =
| width2 =

<!--Clinical data-->
| tradename = 
| pregnancy_category = 
| legal_status = Investigational
| routes_of_administration =

<!--Pharmacokinetic data-->
| bioavailability = 
| metabolism = 
| elimination_half-life = 
| excretion =

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|}}
| CAS_number = 508233-95-2
| ATC_prefix = none
| ATC_suffix = 
| PubChem = 
| IUPHAR_ligand =
| ChEMBL_Ref =
| ChEMBL =
| DrugBank_Ref =
| DrugBank =
| KEGG = D10170
| KEGG_Ref = {{keggcite|correct|kegg}}
| synonyms = Lu AA24530; Lu-AA-24530

<!--Chemical data-->
| C = 18 | H = 21 | N = 1 | S = 1
| molecular_weight = 283,43 g/mol
| smiles = CC(C=C1)=CC=C1SC2=C(C3CCNCC3)C=CC=C2
| PubChem = 9878913
| IUPHAR_ligand =
| ChEMBL_Ref =
| ChEMBL =
| DrugBank_Ref =
| DrugBank =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 8054590
| InChI = 1/C18H21NS/c1-14-6-8-16(9-7-14)20-18-5-3-2-4-17(18)15-10-12-19-13-11-15/h2-9,15,19H,10-13H2,1H3
| InChIKey = CVASBKDYSQKLSO-UHFFFAOYAT
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C18H21NS/c1-14-6-8-16(9-7-14)20-18-5-3-2-4-17(18)15-10-12-19-13-11-15/h2-9,15,19H,10-13H2,1H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = CVASBKDYSQKLSO-UHFFFAOYSA-N
}}

'''Tedatioksetin''' (''Lu AA24530'') je [[antidepresiv]] koji je u razvoju za tretman [[klinička depresija|kliničke depresije]] (MDD).<ref name="urlDevelopment programme - Lundbeck">{{cite web | url = http://investor.lundbeck.com/pipeline.cfm | title = Pipeline | format =  | work =  | accessdate = 4. 10. 2012. | archive-date = 2012-09-28 | archive-url = https://web.archive.org/web/20120928080247/http://investor.lundbeck.com/pipeline.cfm | dead-url = yes }}</ref><ref name="urlSearch of: Lu AA24530 - List Results - ClinicalTrials.gov">{{cite web | url = http://clinicaltrials.gov/ct2/results?term=Lu+AA24530 | title = Search of: Lu AA24530 - List Results - ClinicalTrials.gov | format = | work = | accessdate = }}</ref> Tedatioksetin deluje kao [[Inhibitor preuzimanja serotonina–norepinefrina–dopamina|trostruki inhibitor preuzimanja]] ([[Serotonin|5-HT]] > [[Norepinefrin|NE]] > [[Dopamin|DA]]). On je isto tako [[antagonist (farmakologija)|antagonist]] na [[5-HT2A receptor|5-HT<sub>2A</sub>]], [[5-HT2C receptor|5-HT<sub>2C</sub>]], [[5-HT3 receptor|5-HT<sub>3</sub>]] i [[Alfa-1A adrenergički receptor|α<sub>1A</sub>-adrenergičkim receptorima]].<ref name="urlUSPTO Applications - Publication No. 20100144788 - 4- [2- (4-METHYLPHENYLSULFANYD-PHENYL] PIPERIDINE WITH COMBINED SEROTONIN AND NOREPINEPHRINE REUPTAKE INHIBITION FOR THE TREATMENT OF ADHD, MELANCHOLIA, TREATMENT RESISTENT DEPRESSION OR RESIDUAL SYMPTOMS IN DEPRESSION">{{cite web | url = http://www.surechem.org/index.php?Action=document&docId=2466996&db=USPTOA&tab=desc&lang=EN&db_query=4%3A2%3A0%3A%3A4%3A2%3A0%3A%3A4%3A2%3A0%3A&markupType=all# | title = SureChem - Document - USPTO Applications - Publication No. 20100144788 | format = | work = | accessdate =  9. 10. 2012.}}</ref><ref name="Stahl2008">{{Cite book |last= Stahl|first=Stephen M.| title = Depression and bipolar disorder: Stahl's essential psychopharmacology |url=http://books.google.com/books?id=zqvVZOea2JAC&pg=PA206 | accessdate = 22 November 2011 | date =  19. 5. 2008. | publisher = Cambridge University Press | isbn = 978-0-521-88663-5 | pages=206}}</ref><ref name="Stolerman2010">{{Cite book |last= Stolerman|first=Ian P.| title = Encyclopedia of Psychopharmacology |url=http://books.google.com/books?id=qoyYobgX0uwC&pg=PA105 | accessdate = 22 November 2011 | date =  30. 8. 2010. | publisher = Springer | isbn = 978-3-540-68698-9 | pages=105}}</ref><ref name="urlLu AA24530 shows positive results in major depressive disorder phase II study - FierceBiotech">{{cite web |url=http://www.fiercebiotech.com/press-releases/lu-aa24530-shows-positive-results-major-depressive-disorder-phase-ii-study | title = Lu AA24530 shows positive results in major depressive disorder phase II study - FierceBiotech | format = | work = | accessdate = }}</ref><ref name="urlFuture Treatments for Depression, Anxiety, Sleep Disorders, Psychosis, and ADHD -- Neurotransmitter.net">{{cite web | url = http://www.neurotransmitter.net/newdrugs.html | title = Future Treatments for Depression, Anxiety, Sleep Disorders, Psychosis, and ADHD -- Neurotransmitter.net | format = | work = | accessdate = }}</ref>

== Povezano ==
* [[Vortioksetin]]

== Reference ==
{{reflist|2}}

== Literatura ==
* {{Cite book |ref= harv|last= Stolerman|first=Ian P.| title = Encyclopedia of Psychopharmacology |url=http://books.google.com/books?id=qoyYobgX0uwC&pg=PA105 | accessdate = 22 November 2011 | date =  30. 8. 2010. | publisher = Springer | isbn = 978-3-540-68698-9 | pages=105}}
* {{Cite book |ref= harv|last= Stahl|first=Stephen M.| title = Depression and bipolar disorder: Stahl's essential psychopharmacology |url=http://books.google.com/books?id=zqvVZOea2JAC&pg=PA206 | accessdate = 22 November 2011 | date =  19. 5. 2008. | publisher = Cambridge University Press | isbn = 978-0-521-88663-5 | pages=206}}

== Spoljašnje veze ==
{{Portal-lat|Medicina|Hemija}}
* [http://hugin.info/130085/R/1326803/312416.pdf Lu AA24530 shows positive results in major depressive disorder phase II study]

{{-}}
{{Antidepresivi-lat}}
{{Adrenergici-lat}}
{{Dopaminergici-lat}}
{{Serotonergici-lat}}

[[Kategorija:Antidepresanti]]