SRSEB Chem Module-1
SRSEB Chem Module-1
Chemistry Module
12/3/2023
Focusing on four subjects namely Mathematics, English, Physics and Chemistry this module
provides short notes (summarize Grade 9 – Grade 12 text books) as well as previous year ESSLCE
exam along with solution. Since the short notes includes only relevant formulas and definition,
from the exam point of view, it will help the student to be focused and save time. However, this by
no means is a substitution for the text book.
Indeed, access to short notes that summarize high school syllables will helps the students to
review the whole high school syllables in short time and hence be time effective. In addition,
the previous year ESSLCE exam paper and its solution will allow the students to practice and learn
from mistake.
Dawit Alemu
Chemistry Lecturer at Jigjiga University.
2
Study Tips
ESSLCE is one of the crucial exams for students as it determines whether the students will join
Universities or not. It is important that students try to get a good hold on the concepts being
taught as well as be familiar with ESSLCE exam pattern. The following are some general
preparation tips for the ESSLCE:
Textbooks
Stick to the textbooks and have few good reference books for more understanding.
Study in Groups
It’s always more fun to study with friends. Group learning helps students to grasp things more
quickly. In addition, boring topics will become interesting in group study sessions, allowing
students to extend their study time.
3
CONTENT
Chemistry
4
EDUCATIONAL ASSESSMENT AND EXAMINATION SERVICE ETHIOPIAN
SECONDARY SCHOOL LEAVING CERTIFICATE EXAMINATION (ESSLCE)
3. Which functional group containing compound is named using the suffix "-ol"?
A. Hydroxyl C. Carboxyl
B. Phenyl D. Aryl
A reaction was carried out with 2.5g of N2O5 samples at 335K and after 109 seconds, 1.50 of N2O5
remained. What is the value of the rate constant?
5
7. What is the difference between reversible and irreversible reactions?
A. In reversible reactions, the reaction goes to completion. ducts and reactants.
B. In irreversible reactions, there is a mixture of products
C. In reversible reactions, there is equilibrium between reactants and products.
D. In irreversible reactions, there is equilibrium between reactants and products.
8. Consider the reactions all given bellow are in gaseous states. For which of the following reactions
is Kp less than Kc?
A. N2O4 2NO2
C. 2HI H2 + I2
D. N2 + O2 2NO
9. The heating curve shown below shows a substance in the solid, liquid and gas phase. Which
segment represents only the liquid phase?
100
6
12. What is oxidation'? Oxidation is
A. The addition of electron(s) to the oxidizing agent.
B. The reduction of the oxidation state of the oxidizing agent.
C. The addition of hydrogen to a substance and the removal of oxygen from a substance.
D. The loss of electrons by' a species, accompanied by an increase in oxidation number.
13. What is meant by preferential discharge, if a number of ions are present in a solution? It means that
the one which requires
A. Highest energy will be liberated first at a given electrode.
B. Highest energy will be liberated last at a given electrode.
C. Least energy will be liberated first at a given electrode.
D. Least energy will be liberated last at a given electrode.
14. Faraday's Second Law states:
A. The amount of a substance consumed or produced at an electrode is directly proportional to
the quantity of electricity passing through.
B. The amount of a substance consumed or produced at an electrode is inversely proportional
to the quantity of electricity passing through.
C. Passing the same quantity of electricity through solutions that are of different directly
electrolytes produces masses of substances proportional to their molecular masses.
D. Passing the same quantity of electricity through solutions of different electrolytes produces
masses of substances that are directly proportional to their equivalent masses.
15. Which of the following is true about Zn-Cu voltaic cell?
A. The electrons flow from right to left through the external circuit.
B. As the cell operates, electrons are continuously generated at the cathode and consumed at
the anode.
C. The anode half-cell consists of Cu electrode dipped into a Cue solution.
D. After the cell runs for several hours, the Zn electrode weights less.
16. What is the significance of electron probability distribution? It tells us about
A. Finding the electron very close to the nucleus at all times.
B. The probability of finding an electron is very far away from the nucleus.
C. The uncertainty to assign fixed path for electrons.
D. Finding the electron in its orbit at a particular time.
7
17. Which group in the periodic table contains elements with the valance electron configuration of
ns2np1?
A. III C. I
B. IV D. II
18. Which of the following is a correct Lewis structure for diazomethane (CH2N2).
A. C.
B. D.
19. Which of the following is a property of covalent compounds? Covalent compounds
A. Is generally insoluble in water.
B. Is a crystalline solid at room temperature.
C. Is non-volatile.
D. Has high melting and boiling points.
22. How many moles of C12H22011 (sucrose Molecular weight = 342.91 g mol) is needed there to
prepare 2.0L of 0.3 M solution?
A. 0.6 B.6.6 C. 0.15 D.0.43
8
23. At 75 the vapour pressure of pure water is 39 kPa, pressure of a solution obtained by dissolving
34.2 g sucrose in 180 mL of water? (Assume that the density of water is I .000 g/mL)
A. 41.1 kPa C. 31.2 kPa
B. 44.5 kPa D. 38.6 kPa
24. Which of the following statements is NOT true about the colligative properties of electrolytes and
non-electrolytes?
A. The effect of non-electrolytes on colligative properties is very low compared to
electrolytes.
B. The effect of non-electrolytes on colligative properties is the same as those of electrolytes.
C. The effect of electrolytes on colligative properties is very high compared to non-
electrolytes.
D. The colligative properties of non-electrolytes are not considerably changed.
25. For the reaction below, which of the following is conjugate acid base pair?
HC2O4-(aq) + H2O(l) ↔ H3O+ +C2O4-2
26. What is the purpose of synthetic cryolite in the extraction of aluminium by the Hall’s process?
A. Cryolite increases the melting point of almunia.
B. Cryolite is used as a catalyst in the extraction of' alulninum.
C. Cryolite increases the purity of the extracted all!' nil I um.
D. Cryolite reduces the melting poin( of almunia
C. Aluminum liberates hydrogen gas frorn dilute acids like HCI and H2S04
D. Aluminum is a grey metal in color.
9
28. How is tanning carried out? In tanning the hides or skins are
A. Treated with chromium salts.
B. Treated with dilute hydrochloric acid to remove the lime.
C. Soaked in water for several days.
D. Soaked in lime and water for several days.
29. How can a project of establishing an industry that consumes coal affect the environment?
A. Production of high level of lead in the atmosphere
B. By changing the pH of water
C. Increment in concentration of nitric oxide
D. Rise in global temperature
31. Which of the following postulates of Dalton's atomic theory was modified by the modern atomic
theory?
A. Atoms are neither created nor destroyed in chemical reactions.
B. Compounds are formed when atoms of more than one element combine.
C. Atoms are the smallest particles of all elements.
D. Atoms are indivisible and indestructible.
32. Which of the following includes all of the known atomic models?
A. Bohr Model, the Quantum Mechanical Model, Rutherford Model, Thomson Model, Dalton
's Atomic Model
B. Bohr Model, Thomson Model, Rutherford Model, Dalton's Atomic Model, de Broglie
Model
C. Bohr Model, Quantum Mechanical Model, Dalton's Atomic Model, Valence Bond Model
D. Bohr Model, the Quantum Mechanical Model, Thomson Model, Rutherford Model
10
33. The electro configuration of Cu (Z=29) is
A. [Kr]4s23d9 C. [Ar]4s23p8
B. [Ar]4s13d10 D. [Ar]4s23d9
34. What does Mendeleev's Periodic Law state? properties of elements are periodic functions of their.
A. Electron configurations. C. Atomic numbers
B. B Atomic radius D. Atomic masses.
35. Among the following reactions which one shows a coordinates covalent bond formation?
36. What is the mole ratio of oxygen gas to carbon dioxide gas in the following reaction?
C3H8 (g) + 502 (g) =3C02 (g) + 4H20 (l)
A. 2 mole oxygen gas to 3 mole carbon dioxide
B. 7 mole oxygen gas to 5 mole carbon dioxide
C. C. 10 mole oxygen gas to 6 mole carbon dioxide
D. 5 mole oxygen gas to 3 mole carbon dioxide
37. Consider the following chemical equation for the combination of ethane (C6H6) in the presence of
oxygen to produce carbon dioxide and water.
2C2H6(g) +7O2(g) → 4CO2(g) + 6H2O(l)
In this reaction:
A. water is formed at a rate equal to 2/3 the rate of formation of CO2
B. CO2 is formed twice as fast ethane is consumed
C. The rate of consumption of ethane is 7 times faster than the rate of consumption of oxygen.
D. the rate formation of CO2 equals the rate formation of water
11
38. Which of the following factors DOESNOT affect the rate of a reaction?
A. Ttemperature B. Enthalpy C. Concentration D. Surface area
12
44. For a reaction:
1/2A → 2B, the rate of disappearance of A is related to the appearance of B by the expression:
A. - = C.- =
B. - = D. - =
46. For the conversion of 3.5yards into meter using the factor label method, which of the
47. In the scientific method, a predictive statement that can be tested experimentally is:
A. Proof. B. Hypothesis C. Truth. D. Evidence
48. Which of the following is NOT true about cathode rays? Cathode rays
13
49. Which of the following statements is correct about the energy of a photon?
A. It is directly related to the intensity of the light.
B. It is directly proportional to the wave length of the light.
C. It is directly proportional to the observed frequency of the light.
D. It is inversely proportional to the observed frequency of the light.
50. Which of the following explains the emission spectra of atoms consisting of a series of fine lines?
A. The energy of the atoms is continuous with discreet frequencies.
B. An electron that revolves around the nucleus emits radiation.
C. An electron can have specific energy values in an atom.
D. An electron undergoes a transition by energy changes corresponding to photon of specific
wave length
54. The process in which a compound absorbs electrical energy and decomposes into its element is
A. Hydrolysis. C. Electrolysis.
B. Electroplating. D. Solvolysis.
14
55. Which of the following is five about galvanic cells used in commercial lead storage batteries? In
lead storage batteries,
A. Half of the galvanic cells are connected in series.
B. The galvanic cells are made up ofPbO2 of anodes.
C. Galvanic cells are connected in series.
D. Galvanic cells are connected in parallel.
Which of the following is the correct expression of the ionic product of water?
A. [H3O+] [OH-] C. Kw = Kc (H2O)2
B. [H3O+] [OH] / [H2O] D. Kw = Kc (H2O)
A. a weak acid and a weak base and the cation of the weak base can hydrolyzed.
B. a strong acid and a weak base and the anion of the strong acid can be hydrolyzed.
C. a strong base and a weak acid and the anion of the weak acid can be hydrolyzed.
D. a strong base and a strong acid and the anion of the strong acid can be hydrolyzed.
A. -775 J C. 775 J
B. -535 J D. 535 J
61. Which statement describes the formation of a covalent bond? In covalent bond electrons are
63. How is hydrogen bonding formed? It is formed when a hydrogen atom is bonded to
A. Highly electronegative elements, chlorine, oxygen and nitrogen.
B. Highly electronegative elements, fluorine, oxygen and nitrogen
C. Highly electronegative elements, fluorine, chlorine and oxygen.
D. Highly electronegative elements, fluorine oxygen and phosphorus.
64. Which one of the following forms of energy change occurs from the combustion of carbon in
oxygen is
A. Heat energy. C. Light energy.
B. Solar energy. D. Electrical energy.
16
65. What is the molar volume of a gas?
A. The volume of a gas at STP (standard temperature OOC and pressure kPa), which is equal
to 22.4 L/mol.
B. The volume of a gas at STP (standard temperature 25 0C and pressure kPa), which is equal
to 22.4 L/mol.
C. The volume of a gas at STP (standard temperature, OOC and pressure atm.), which is equal
to 22.4 L/mol.
D. The volume of a gas at STP (standard temperature 25 0C and pressure atm.), which is equal
to 22.4 L/mol.
66. Which of the following assumptions of the kinetic molecular theory of gases explains the high
compressibility of gases?
A. Particles are always in random motion.
B. Different particles have different speeds.
C. The actual volume of gas molecules in negligible,
D. There is no force of attraction between gas molecules.
67. Consider a bottle containing water, water vapor and air in equilibrium. If the temperature decreases
slightly, the amount of water vapors
68. Why do water droplets collect on the outside of a glass of water on a hot day?
A. There will be a condensation of water vapor on the glass.
B. There will be a sublimation of water vapor on the outside of a glass.
C. There is heat exchange between the water in the glass and the surrounding.
D. Water from the glass starts to vaporize.
17
70. Which of the following statement is INCORRECT regarding the boiling points of alkanes?
A. Boiling points of straight chain alkanes is greater than that of branched chain alkanes.
B. The boiling point of cycloalkanes is higher than that of linear alkanes.
C. Boiling points increases with stronger Van der Waals forces.
D. Surface area is the only factor that determines the boiling points of alkanes.
71. Which of the following statements is NOT correct about minerals and ores?
A. Minerals are the natural forms in which various metals exist.
B. Ores are usually used to extract metals economically.
C. All minerals are ores.
D. All ores are minerals.
72. Why is CaC12 added to NaCl in a l : l- ratio in the Down's ct manufacturing of sodium metal?
A. CaC12 is used to lower the density of the mixture.
B. CaC12 is used as an electrolyte.
C. CaC12 is used as a catalyst.
D. CaC12 is used to lower the melting temperature of NaCl
B. Tetrafluoroethylene D. Propylcnc
18
75. Which of the following represents the structure of a disaccharide?
76. Which of the following carboxylic acid is a solid substance at room temperature?
A. Nonanoic acid C. Hetanoic acid
B. Decanoic acid D. Octanoic acid
77. What is the IUPAC name of an ester having the molecular formula C6H12O2?
A. Ethyl butyrate C. Ethyl butanoate
B. Pentyl butyrate D. Methyl butyrate
A. CH3(CH2)2COOH C. CH3(CH)4COOH
B. CH3(CH2)5COOH D. CH3(CH2)3COOH
19
79. What is the rate of dissolution?
A. It is A. the rate at which a solid dissociates.
B. The speed at which a solid sublimes.
C. The rate at which a solid turn to liquid.
D. the speed at which a solid substrate goes into solution
80. Which one of the following is correctly stated regarding solubility as an equilibrium
process?
A. Supersaturated solution is a solution that contains more than the equilibrium amount of
dissolved solute.
B. Supersaturated solution is more stable than saturated solution.
C. Unsaturated solution is a solution that is in equilibrium with respect to a given dissolved
substance.
D. Saturated solution is a solution in which more of the solute can be dissolve.
20
EDUCATIONAL ASSESSMENT AND EXAMINATION SERVICE ETHIOPIAN
SECONDARY SCHOOL LEAVING CERTIFICATE EXAMINATION (ESSLCE)
1. B ...b/c
Alkynes have shorter bond length than alkene.
Alkene and alkynes are insoluble in water (they are non-polar).
2. C...b/c
The general formula of alkynes are CnH2n-2 (n ), ethyl is the simplest alkyne molecule
CnH2n+2 for alkane
3. A...b/c
The functional group of an alcohol is the hydroxyl group (–OH).
4. B...b/c
The monohydric alcohols are the hydroxyl derivative of hydrocarbons where only one of
the Hydrogen atom (H) has been replaced by a Hydroxyl (OH) group.
It has the general formula CnH2n+1OH
5. D...b/c
Some of the definition of acids and base include
A Lewis acid is an electron-pair acceptor.
6. D...b/c
The 3 common order of rxn with their formula
Zero Order Reaction
21
[A]t =-kt + [A]o
First-Order Reactions
ln = -kt
Second-Order Reaction
= kt +
[A]t = 1.50, [A]o = 2.50, t = 109sec, substitute each value in the given formula
k= = = 4.69 10-3s-1
[A]t = 1.50, [A]o = 2.50, t = 109sec, substitute each value in the given formula.
7. C...b/c
In reversible reactions, there is equilibrium between reactants and products.
In irreversible reactions, there is no equilibrium between reactants and products
8. B...b/c
Kp = Kc (RT)n
n = (moles of gaseous product) - (moles of gaseous reactant)
Kp = Kc (RT)n = Kp = Kc (RT)-1
C, in 2HI H2 + I2 , n = 2 -2 = 0
Kp = Kc (RT)n = Kp = Kc (RT)0 = Kp = Kc
D, in N2 + O2 2NO , n = 2 – 2 = 0
22
Kp = Kc (RT)n = Kp = Kc (RT)0 = Kp = Kc
9. A...b/c
In Region 1, solid phase In region 2, Liquid/solid phase
In region 3, Liquid phase In region 4, Liquid / Vapor phase In region 4, Vapor phase
10. A...b/c
Carboxylic acids are organic compounds containing the carboxyl group (-COOH), wherein
the hydroxyl group (-OH) is directly attached to the carbonyl (C=O) group.
Three representation of carboxylic acid, Such as
11. D...b/c
The heat absorbed or released by a system at constant pressure is called enthalpy (H)
H = E + PV
12. D...b/c
Oxidation is the loss of electrons and is identified by an increase in oxidation number.
Reduction is the gain of electrons and is identified by a decrease in oxidation number.
13. C...b/c
According to the preferential discharge theory, out of a number of ions, the one which
requires least energy will be liberated first at a given substance.
14. D...b/c
Faraday's First Law of Electrolysis states that “The mass of a substance deposited at any
electrode is directly proportional to the amount of charge passed.”
23
Faraday's second law of electrolysis states that if the same amount of electricity is passed
through different electrolytes, the masses of ions deposited at the electrodes are directly
proportional to their chemical equivalents mass.
15. D...b/c
At standard condition the mass of copper electrode increase and the concentration of
CU2+in the solution around the copper electrode decrease as the operate.
The mass of zinc electrode decrease and the concentration of Zn+2 in the solution around
the zinc electrode increase as the operate
16. D...b/c
There is a certain probability of finding the particle at a given location, and the overall
pattern is called a probability distribution.
17. A...b/c
In the periodic table the group 3 elements such as boron, aluminum gallium, indium
cetanium, these have the valence electronic configuration of ns2np1.
18. B...b/c
This is the most stable Lewis structure of diazomethane (CH2N2) because the carbon (C)
and nitrogen (N) atoms have complete octets. The structure is H2C=N=N for diazomethane
and there are 2 lone pairs of electrons on the terminal nitrogen.
19. A...b/c
20. C...b/c
24
A covalent bond is formed when a pair of electrons is shared between two atoms. Some
examples of covalent molecules are HCl, H2S, C2H4, N2, CCl4, BCl3, H2O, NH3, SO2, PCl5,
O3, etc. Generally, substances that contain covalent bonds are called molecules.
21. C...b/c
The concentration of a solution is a measure of the amount of solute that has been dissolved
in a given amount of solvent or solution.
22. A...b/c
C= , n= C V(L) where C= concentration, n= mole, V= Volume in litter
n = 0.3 2 = 0.6
23. D...b/c
Pi = Xi Po, where Po = vapor pressure of pure solvent, Pi = vapor pressure of solution, xi =
mole fraction of solvent
Xi =
n of H2O = = 10 mol
Xi = = 0.99
24. B...b/c
Electrolytic solution produce greater colligative effect than non electrolytic solution.
25. B...b/c
Once an acid has given up a proton, the remaining part can be a proton acceptor and is,
now called a conjugate base. On the other hand, when a base accepts a proton, the species
formed is called conjugate acid. The conjugate base has one less H and one more minus
charge than the acid. The conjugate acid has one more H and one less minus charge than
the base
26. D...b/c
25
Cryolite helps the lower melting point of Alumina to around 900° C - 950 ° C in the
electrolytic reduction process of Aluminum extraction. It brings the Alumina in molten
form and makes it a good conductor of electricity for the electrolysis process.
27. C...b/c
Al (s) + 3HCl (aq) AlCl3 (aq) + H2 (g)
28. A...b/c
Tanning process is applied in leather industry To prepare the hides for the process of
tanning, the hair, grease, fat and salt is removed, and then the hide is treated with trivalent
chromium salt
29. D...b/c
Air pollution from coal-fired power plants is linked with asthma, cancer, heart and lung
ailments, neurological problems, acid rain, global warming, and other severe environmental
and public health impacts.
30. B...b/c
Fundamental quantities are those that have no reliance on any other physical quantity for
their measurement. A derived quantity is the sum, the products and/or ratios of the
fundamental quantities in a system of units. Fundamental quantities are: time, length, mass,
electric current, thermodynamic temperature, amount of substance, and luminous intensity.
Derived units are velocity, power, energy, force and density.
31. D...b/c
The basic postulates of Dalton’s Atomic
A. All elements are made up of small particles called atoms.
B. Atoms are indivisible and indestructible.
C. All atoms of a given element are identical in mass and in all other properties.
D. Atoms are neither created nor destroyed in chemical reactions.
E. Compounds are formed when atoms of more than one element combine.
F. In a given compound, the relative numbers and types of atoms are constant.
The Modern Atomic
26
i. Atoms are the smallest particles of all elements that can take part in a chemical
reaction.
ii. An atom is divisible. It can be subdivided into electrons, protons, and neutrons. An
atom is also indestructible i.e., atoms can neither be created nor destroyed during
ordinary chemical reactions.
iii. Atoms of the same element may not be identical in mass because of the existence of
isotopes.
iv. Atoms of the same elements have identical chemical properties.
v. Atoms of different elements have different chemical properties.
vi. Atoms of two or more elements combine in simple whole-number ratios to form
compounds.
32. A...b/c
Known Atomic models
i. the Dalton atomic model
ii. the Thomson model
iii. the Rutherford model
iv. the Bohr model
v. the quantum mechanical model
33. B...b/c
The electron configuration of CU (Z = 29) is 1S2 2S2 2P6 3S2 3P64S1 3d10 but due to full
and half-filled principle[Ar] 4S1 3d10
34. D...b/c
Mendeleev's periodic law states that the properties of the elements are periodic functions of
their atomic masses.
35. D...b/c
A covalent bond in which one atom donates both electrons of the bond is called a
coordinate covalent bond.
27
36. D...b/c
C3H8 (g) +5O2 (g) → 3CO2 (g) + 4H2O (l)
= = 5O2 = 3CO2
37. B...b/c
2C2H6 (g) +7O2 (g) → 4CO2 (g) + 6H2O (l)
r C2H6 = r O2 = r CO2 = r H2O where r=rate of reaction
38. B...b/c
Factors affecting the rate of reactions are
i. Concentration of reactant
ii. Nature of reactant
iii. Surface area of reactant
iv. temperature of reactant
v. Catalysts
39. A...b/c
Catalyst increase the rate of reaction by providing a new path by lowering the activating
energy
28
40. D...b/c
Boyles law, states that the volume of a fixed amount of gas maintained at constant
temperature is inversely proportional to the gas pressure.
41. C...b/c
Intermolecular foresees are forces that hold molecules together. These are attraction
between one molecule and a neighbouring molecule
42. D...b/c
Chemical bonding theories are
1. The volume bond theory 2. The molecular orbital theory
43. A...b/c
Two electron sets on the central atom is called SP hybridization (S +P)
Three electron sets on the central atom is called SP2 hybridization (S +P +P)
Four electron sets on the central atom is called SP3 hybridization (S +P +P +P)
Five electron sets on the central atom is called SP4 hybridization (S +P +P +P +P)
One lone pair, one single bond, one double bound, and one triple bond each used as one
electro sets
44. B...b/c
A → 2B
Rate = - =
- = ,
45. C...b/c
The half-life of a reaction isthe time required for the concentration of one of the reactants
to decrease to half of its initial value.
46. C...b/c
Multiply the number with the correct conversion factor
29
47. B...b/c
In the scientific method, an idea or proposition that can be tested by observation or
experiments about the natural world is called hypothesis
48. A...b/c
Properties of cathode rays are
i. they travel in straight line
ii. they have negatively charged particles
iii. Common constituents of all matter and their m/e is constant for all gases
49. C...b/c
Energy of a photon is directly proportional to frequency of light but inversely proportional
to the wavelength.
50. C...b/c
Each electron in an atom is associated with a particular energy level of the atom.
51. D...b/c
Polyprotic acid contains more than one ionizable hydrogen atom.
52. C...b/c
The general properties of base are
i. Good conductor electricity in aqueous or molten state
ii. Release hydroxide ion in aqueous solution
iii. Methyl orange change to yellow
iv. red litmus paper change to blue
53. A...b/c
Salts are ionic compound obtained by neutralization reaction. The positive ion obtained
from base and the negative ion obtained from acid.
54. C...b/c
Electrolysis is a process in which the substance undergoes decomposition by passage of
electricity. It converts electrical energy into chemical energy
30
55. B...b/c
In lead storage battery, the PbO2 is chosen as an anode because it is stable
56. A...b/c
H2O (l) + H2O (l) H3O (aq)+ + OH- (aq)
K= =
57. A...b/c
Adding a common ion in electrolytic solution decrease the solubility of a solute, as the
reaction shifts towards the left to relative the stress of the excess product.
58. C...b/c
Because sodium carbonate is formed from strong base (NaOH) and weak acid (H2CO3)
59. A...b/c
Acid base titration is a method of quantitative analysis for determination the concentration
of an acid or base.
60. C...b/c
ΔE = q + w, where, E is internal energy, q is heat, w is work
q = +650J, w= +125J
Heat gain by system is positive
Work on the system is positive
ΔE = 650 J + 125 J = 775J
61. A...b/c
Covalent bond is formed by sharing of electrons between non-metal elements
62. A...b/c
Group IIV elements like Be, Mg, Ca form ion by losing 2 electrons because valence
number of group IIV elements are two.
63. B...b/c
31
Hydrogen bond is formed when hydrogen atom is bonded to highly electronegativity
elements (F, O, & N).
64. A...b/c
During combustion reaction of carbon in oxygen produce carbon dioxide, and heat.
C + O2 → CO2 + Heat
65. C...b/c
At standard condition
Temperature(T) = 0 = 273 K =32
66. B...b/c
Not all of the molecules of a particular gas at a given temperature move at exactly the same
speed.
67. D...b/c
In equilibrium temperature directly proportional with water vapor and vapor pressure.
68. C...b/c
There is heat exchange between the water in the glass and the surrounding.
69. D...b/c
Hydrocarbons are organic compounds that contain only carbon and hydrogen atom.
70. D...b/c
Factor for determination boiling point of alkane.
i. Surface area
ii. Number of carbon
iii. Chain or branch
71. C...b/c
32
Minerals are naturally occurring inorganic solids with a crystalline structure and a definite
range of chemical formula. Ores are concentrations of minerals in rock that are high
enough to be economically extracted for use. All ores are minerals, but all minerals are not
necessarily ores.
72. D...b/c
Because CaCl2 is added to lowering the melting point of NaCl.
73. C...b/c
A major step in metallurgical process are,
i. Concentration the ore
ii. pre-treatment
iii. production of metals
iv. Refining and alloying
74. B...b/c
The structure of Teflon is
75. B...b/c
Disaccharides are composed of two monosaccharide units linked together by a glyosidic
bond. The most common glycosidic bonds connecting monosaccharide units are O-
glycosidic bonds in which the oxygen from a hydroxyl group becomes linked to the
carbonyl carbon.
76. B...b/c
Carboxylic acids with higher molecular weights are solids at room temperature.
77. C...b/c
IUPAC name of ester is alkyl alkanoate as it contains two alkyl group on both side
(RCOOR′). Suffix for ester group is -oate and prefix is alkoxycarbonyl.
33
78. D...b/c
Pentanoic acid is carboxylic acid that contain 5 carbon atoms, 10 hydrogens and 2 oxygen.
(CH3CH2CH2CH2COOH)
79. D...b/c
Rate of dissolution is the speed at which the solute enters in to a solution.
80. A...b/c
Unsaturated solution is a solution where the quantity of solute added is below the solution's
saturation point at a fixed temperature.
Saturated solution is a solution formed when the maximum amount of solute has been
dissolved in a solvent and equilibrium is reached. Super saturated solution is a solution that
contain more solute than the saturated amount.
34
EDUCATIONAL ASSESSMENT AND EXAMINATION SERVICE ETHIOPIAN
SECONDARY SCHOOL LEAVING CERTIFICATE EXAMINATION (ESSLCE)
35
4. All of the following are example of addition polymer EXCEPT
A. -[CH2-CH2] n-
B. -[CH2-CHCl] n-
C.
D. -[CH2-CH2] n--[CH2-CH(CH2)] n-
5. One of the following examples of polymers is correctly matched with its uses.
A. Polyethylene: food containers
B. Polypropylene: electrical insulation
C. Polyvinyl Chloride = making Pipes
D. Polytetrafluoro ethylene: making shoes
7. The branch of chemistry that is involved in separation, identifying and determining the relative
amounts of components in a sample of material is known as
A. Biochemistry
B. Analytical Chemistry
C. Physical chemistry.
D. Inorganic chemistry.
36
C. Measured values with the highest uncertainty.
D. Exactly known digits with the last digit’s uncertainty.
10. For the determination of the density of a new ceramic, a student measured the
mass of a piece on an analytical balance and obtained 3.8056 gram and its
volume 2.5mL by displacement of water in a graduated cylinder. The correct
reported density of the ceramic should be
A. 1.5222 g/mL
B. 1.5224 g/mL
C. 1.5 g/mL
D. 3.5 g/mL
12. One of the following is NOT true about the effects of corrosion?
37
13. In the Galvanic cell given in the diagram below
Identify the component parts correctly labeled for the letters a, b, c. d respectively
A. Zinc anode copper cathode, salt bridge, voltmeter
B. Copper anode, Zinc cathode. voltmeter, salt bridge
C. Zinc anode copper cathode. ZnS04(sol). salt bridge
D. Copper cathode, zinc anode, CuS04(sol). Voltmeter
14. The conversion of nitrogen gas into useful nitrogen compounds is known as
A. Respiration.
B. Photosynthesis.
C. Fixation
D. Oxidation.
15. CO2 is released into the atmosphere by one of the following process
A. Plants consume atmospheric carbon dioxide during photosynthesis.
B. Animals eat plants and release CO2 by photosynthesis.
C. Natural fires and volcanoes release CO2 in to the air
D. Utilization of electrical energy as energy sources.
38
17. The sanitizer in wide use for protection against COVID-19 is labeled 83% alcohol. How can one
scientifically check the concentration? This can be done by
A. Forming a hypothesis
B. Experimentation
C. Collection of data
D. Making observation
18. Which of the following is true about isotopes? Isotopes of an element have
A. The same number of electrons and neutrons
B. Different number of neutrons and the same number of protons.
C. C. Different physical and chemical properties
D. The same atomic mass but different atomic numbers
19. The following diagrammatic representation shows the shape for various orbitals?
A. C.
B. D.
107 109
20. Silver (Z=47) has several known isotopes, but two occur naturally, Ag and Ag. Given the
following mass spectrometric data, calculate the atomic mass of A
39
A. 108.9amu
B. 107.94amu
C. 107.4amu
D. 107.86amu
22. Which one of the following is NOT correct about electrodes and electrochemical cells?
A. Electrons flow spontaneously from negative to positive electrode.
B. The overall cell potential is calculated by the formula.
E0cell = Ecathode - Eanode
C. EOcell is greater than zero for non-spontaneous
D. The difference in the electrical potential of the electrode is positive that is positive cell.
24. In the electrolysis of copper Sulphate solution using graphite electrodes, 0 2 is liberated at the anode and
copper metal is deposited at the cathode. If the electrolysis of CuS04 is performed using copper electrode,
what happens at the anode and cathode?
A. At the anode the copper electrode dissolves and copper metal is deposited at the cathode
B. At the anode H2 is liberated, whereas copper is deposited at the cathode.
C. At the anode copper is reduced, whereas copper is oxidized at the cathode
D. No electrochemical reaction takes place involving copper.
40
25. The statement the amount of a substance consumed or produced in electrolytic cell is directly
proportional to the amount of electricity that passes through the cell' is known
A. Dalton's law.
B. Raoults law.
C. Faradays law
D. Henry's law.
26. Given the following electromotive series of selected metals with their standard reduction potentials
Metal and their EON
Cu = +0.34
Pb = -0.13
Ni = -0.25
Cd = -0.40
Zn = -0.76
Al = -1.66
Ca = -2.87
K = -2.93
Which of the following statements is correct about reactivity of the metals?
A. Cu is the strongest reducing agent in the group.
B. K is the strongest reducing agent among the metal silver
C. The reaction Cu + Zn2+ ↔ Cu2+ + Zn is spontaneous
D. Pb is more easily oxidized than Al.
27. Which of the following statement is correct about energy changes when an electron changes its
energy level?
A. When an electron jumps from a lower energy level to a higher level. the photon emitted is
equal to the difference between the two energy
B. When an electron falls from a higher energy level to a lower energy level, the energy is equal
to the difference between the two energy levels is observed.
C. When an electron falls from a higher energy level to a lower energy level. the energy is higher
than the difference between the two energy levels is emitted.
D. When an electron jumps from a lower energy level to higher energy level, the energy is equal
to the difference between the two energy levels is absorbed.
41
28. The correct electronic configuration for chromium (Cr, Z=24) is
A. 1 s22s22p63s23p63d44d2
B. 1 s22s22p63s23p64s03d6
C. 1s22s22p63s23p64s13d5
D. 1 s22s22p63s23p64s23d4
29. According to Hund's rule equal energy(degenerate) orbitals are filled with
A. Two electrons of opposite spins placed in the first orbitals.
B. Maximum number of unpaired electrons with parallel spins
C. Two electrons of parallel spins placed in the first orbital.
D. Maximum number of unpaired electrons with opposite spins
5
31. The Ka of acetic acid CH3COOH is 1.8 x 10- . What is the percent ionization of 1 M CH3COOH?
A. 3.6
B. 1.42
C. 1.34
D. 4.2
32. In the reaction mixture of the two species NH4OH and NH4Cl
NH4OH ↔ NH4++ OH-
NH4Cl→ NH4+ + Cl-
42
33. Which one of the following is correct about K2 at different temperature? The ionic product of water
Kw equals
Kw 1.0 X 10-14 at 250C, Kw= 1 X 10-7
Kw = 2.92 x 10-14 at 400c, Kw= 1 x 10-7
A. water is dissociate to a higher extent at 400C than 25
B. At 400C pure water is no more neutral.
C. Hydrogen ion concentration at 250C is higher than at 400C.
D. Hydroxyl ion concentration is higher at 400 than hydrogen ion concentration
34. The electrolysis of liquid (molten) NaCl in the set up for the electrochemical cell is given in the
following figure below
Which of the following statements is true about the electrolysis of molten sodium chloride?
A. Cl2 is formed at the cathode
B. Na is oxidized at the anode
C. The net reaction produces Cl2 at the anode Na at the cathode
D. O2 is produced at the anode due to oxidation of water.
43
36. During the electrolysis of dilute aqueous sulphuric acid, the ions present in solution are H+, OH-and
SO4-2. Which ions are preferentially discharged at the cathode and anode, respectively?
38. Covalent compounds are liquids or gases at room temperature and have low melting and boiling
points. Which of the following statements explains these properties of covalent compounds?
A. The intermolecular forces of attraction in covalent compounds are strong.
B. The unit of particles in covalent compounds are ions.
C. There are no forces of attraction between the molecules in covalent compounds.
D. Covalent compound exists as separate molecules.
39. Both carbonyl sulphide, COS (SCO), and carbon dioxide (CO2) are linear molecules. COS is polar
whereas CO2 is non-polar. This is because
A. CO2 has a net dipole moment of zero
B. The C=O bonds in both COS and CO2 are polar.
C. Regions of high negative charge is distributed equally around the central atom in COS.
D. Sulphur is more electronegative than oxygen.
44
40. Which of the following statements is true about the formation of CH4 according to valence bond
theory?
A. The 2s and two 2P orbitals in carbon hybridize to form three sp2orbitals.
B. The 2s and three 2p orbitals in carbon hybridize to form four sp3 orbitals
C. The 2s and one 2P orbitals in carbon hybridize to form two sp orbitals.
D. Carbon can form two hybrid orbitals as it has got only two half-filled orbitals.
41. Phosphorous(Z=15) has the electronic configuration 1s2 2s2 2p6 3s2 3p3, what kind of hybridization
does phosphorous undergo in the formation of phosphorous pentachloride (PCl5)?
A. A.sp3
B. SP3d
C. sp2
D. sp
42. The reaction between a weak acid and strong base as represented by the reaction between acetic
acid and NaOH gives a basic solution because
CH3COOH + NaOH → Na+ + CH3COO- + H2O
A. Na+ is a strong acid and causes high concentration of H+
B. CH3COO- as a strong base picks up H+ and causes execs of OH-ions
C. The OH- ions from NaOH are not completely neutralized.
D. CH3COOH does not produce sufficient amount of ions.
44. One of the following given masses of acids constitutes the corresponding equivalent of the acid
A. H2SO4 = 98 = 2 equivalents
B. HCl = 36.5g = 2 equivalents
C. H3PO4 = 49g = 4 equivalents
D. H3PO4 = 98g = 2 equivalents
45
45. One of the following pairs shows Bronsted-Lowry acids behavior in water? Bronsted Lowry acid
A. HNO3 and NO3-
B. H3O+ and NH3
C. HPO4-2 and PO4-3
D. HCl and NH4+
46. One of the following reactions illustrates the formation of coordinate covalent bond?
A. NaOH + HCI NaCl + 1-120
B. Be + 2F2 → BeF2
C. NH3 + HCl → NH4+ + Cl-
D. CaCO3 + HCI →CaC12 + H2O + CO2
47. Hydrogen bonding occurs in compounds that contain H-N, H-O and H-F bonds. These bonds are
stronger than the ordinary dipole-dipole interactions because
A. The partially positive H of one molecule is attracted to the partially negative lone pairs on the
N, O, or F of another molecule.
B. The H-N, H-O and H-F bonds are less polar than ordinary covalent bonds.
C. The small sizes of N, O and F makes these atoms so electropositive that their covalently
bounded H is highly negative.
D. The H-N, H-O and H-F bonds are non-polar and thus do not interact with neighboring
molecules.
48. Which of the following pair is true about the general properties of the different types of crystalline
solids?
Conduction of
Type of solid Hardness Melting Point
heat of
I. Ionic Hard High Good
II. Covalent Hard High Poor
III. Molecular Soft Low Good
IV. Metallic Soft to hard Low to high Good
A. I and Il
B. Il and Ill
C. I and Il
D. I and IV
46
49. When the boiling points of hydrides of group VIA elements, H20, H2S, H2Se and H2Te are
arranged in the order of increasing boiling point. The trend is H2Te < H2Se < H2S < H2O, water
having the highest boiling point, this is due to
A. The small size of oxygen (O) compared to the other group VIA elements.
B. The basic different structures of each hydride.
C. Increasing boiling points with increasing molecular mass.
D. Hydrogen bonding present in H2O molecules
52. Which of the following reactions represent the amphiprotic behavior of water?
A. NaOH + H2O → Na+ + OH-
B. HCl + H2O ↔ H3O+ +Cl- and NH3 + H2O ↔ NH4+ + OH-
C. H3O+ + OH- → 2H2O and H+ + OH-→ H2O
D. H2O + H+ ↔ H3O+ and NH3 + H+ ↔ NH4+
47
53. What is the pH of 0.25M HF solution at 25 ? The ionization of the weak acid, HF is given by
HF (aq) + H2O (l) ↔ H3O+(aq) + F-(aq)
A. 12.1
B. 1.89
C. 12.3
D. 1.741
54. One of the following given pairs represents examples of buffer systems
A. NaOH / HICI and HNO3 / KOH
B. NH4Cl / H2O and H2O /CH3COONa
C. NH4OH / CH3COOH and NH4Cl CH3COONa
D. NH4OH/ NH4Cl and CH3COOH/CHCOONa
A. The collision between two reacting species results in the formation of an activated complex,
which has less energy than both the reactants and products.
B. In the activated complex, the original bonds are weakened and the new bonds are partially
formed.
C. The activation energy is the energy that must be absorbed or released by reactants to reach the
activated complex.
D. The standard reaction enthalpy (AHO) depends on the magnitude of the activation energy (Ea).
48
57. Which of the following is true about the rate constant?
A. It expresses the relationship between the rate of a chemical reaction and the volume of reacting
species.
B. The value of a rate constant tells us how fast or slow a reaction is
C. The value of a rate constant is Independent of reaction conditions.
D. A small rate constant indicates a faster reaction and a larger rate constant indicates a slower
reaction
58. For a first order reaction. the concentration versus time of the reaction mixture is given by
the following graph.
A. 1
B. 4
C. 5
D. 3
59. The mathematical expression , Logk = + LogA, Derived from the Arrhenius equation is
of important as it shows
A. Reactions with larger activation energies have higher values of k and are therefore faster.
B. For a given value of activation energy, the value of the rate constant increases as the
temperature increase.
C. Reactions with larger activation energies, the (2) value of the rate constant decreases as the
temperature increases.
D. For a given value of activation energy, the value of the rate constant decreases as the
temperature increases.
60. The "like dissolves like" rule accounts for one of the following observation
A. The solubility of C6H6 in CCl4
B. The solubility of C2H6 in H2O
49
C. The solubility of KBr in C7H8
D. The insolubility of 12 in H2O
62. The concentrated sulphuric acid H2SO4 we use in the laboratory 's 98' H2SO4 by mass and has а
density of 1.83g/mL. Below are given the given concentration of the acid in various units. Which
of the alternative correctly describes the соncentration of acid?
65. From the magnitude of the equilibrium constant, Keg one can deduce that
A. Small Keg values indicate the reaction yields very higher amounts of products near
equilibrium.
B. Large Keq value indicates that the reaction reaches equilibrium with very little reactants
remaining.
50
C. Intermediate Keg value indicates that the reaction does proceed in the forward direction.
D. Keq will be larger when we have higher amounts of reactants over products.
66. The statement "If a system at equilibrium is subjected to a stress, the system will readjust itself to
reduce the effects of the stress is known as
A. Faradays law
B. Avogadro's principle
C. Boyle's law
D. Le-Chatelier principle
68. For the reaction between gaseous NO and 02 to form N02(g), what will be the equilibrium constant
expression.
2NO(g) + O2(g) ↔ 2NO2(g)
A. Kc = [NO2]2 / [NO]2[O]
B. KP = (PNO2) / (PNO) (PO2)
C. KP = (PNO2)2 / [PNO] [PO2]
D. KP = (PNO2)2 (PO2) / (PNO2)
69. The equilibrium constant KP for the reaction 2SO2(g) ↔ 2SO2(g) +O2(g) is 3.8 x 10-3Kp at 227
What is the value of Kc for the reaction at the same temperature?
A. 1.8 x 10-3 mol m-3
B. 4.6 x 10-4 mol
C. 9.1 10-4 molm-3
D. 2.3 x 10-4 mol m-3
51
70. The difference between colloids and suspension is that
A. Colloidal particles are small enough and do not settle down unlike suspensions
B. Most colloids and suspensions appear cloudy.
C. Both colloids and suspensions are heterogonous mixtures
D. Colloids are as transparent as solutions.
72. 50mL of the supernatant saturated solution of NaCl was taken in an evaporating dish (weight =
Wo) and evaporated over a Bunsen burner until all the water has evaporated and dry sodium
chloride is left in the evaporating dish. The evaporating dish with the dry sodium chloride is
weighed (weight = W1). Given the following information, Wo = 47.5g and W1 =66.2g. Calculate
the solubility of NaCl in water assuming 50mL of the solution is equal to 50mL of the solvent
73. In the production of NH3 by the Haber process according to the equation
What are the favorable conditions for the production of high yield of NH3?
A. Low pressure and low temperature
B. High pressure and low temperature
C. High pressure and high temperature
D. Low pressure and high temperature
52
74. Which one of the following statements describes laboratory and industrial preparation of acetic
acid respectively?
A. Reduction of toluene by KMnO4
B. Reduction of ethanol by NaBH4 and fermentation of propanol.
C. Oxidation of toluene by KMnO4 and fermentation of ethanol.
D. The oxidation of ethanol by sodium dichromate and fermentation of ethanol.
76. What is the IUPАС name for the branched carboxy1ic acid
CH3-CH(Cl)-CH(CH3)-CH(CH3)-COOH
A. 1, 2-dimethyl-4-chloro- 1 -pentanoic acid.
B. 4-chloro-2- methyl -1-pentanoic acid.
C. 4-Chloro-2,3-dimethyl-1-pentanoic acid.
D. 4-chloro-1-methyl -1 -–pentanoic acid
78. Oils are unsaturated fatty acids. The process of converting oils to solid fats involves
A. Esterification of the acids.
B. Saponification with NaOH
C. Hydrogenations of the C-C double bonds
D. Halogenations of the C-C double bonds.
53
79. A chemistry teacher has added different reactants and reagents in three different test tubes as
described below
I. in to the test tube A he added ethanol, sodium dichromate. sulphuric acid.
II. in to the test tube B he added acetaldehyde, sodium borohydride and water.
III. in to the test tube C he added methyl acetate and ethanol and sodium hydroxide. In which
test tube would a reaction take place that provide acetic acid?
A. III
B. I and Il
C. Il and Ill
D. I
A. Salt
B. Lewis acid
C. Lewis base
D. Bronsted bas
54
EDUCATIONAL ASSESSMENT AND EXAMINATION SERVICE ETHIOPIAN
SECONDARY SCHOOL LEAVING CERTIFICATE EXAMINATION (ESSLCE)
1. We believe there is a mistake in the equation. Let’s see each Choice one by one
Choice A
Si(s) + 2CH3Cl(g) → (CH3)2SiCl2(l)
(CH3)2SiCl2(l) + 2H2O(l) → (CH3)2Si(OH)2(l)+2HCl(g)
(CH3)2Si(OH)(l)→ [(CH3)2SiO]n(s) +nH2O(l)
in the last reaction, the polymer formed is
[(CH3)2SiO]n not. This is incorrect about the chemical properties of silicon.
Choice B
Silicon is resistant to attack by all acids except HF, which it reacts to give SiF4, and H2O not
H2O2
SiO2(s) +4HF(l)→SiF4(g) +2H2O(l)
This incorrect about the chemical properties of silicon
Choice C
Silica dissolves in hot molten Na2CO3 to give NaSiO4 and CO2
SiO2(s) +2Na2CO3(l) → NaSiO4(s) +2CO2
This correct about the chemical properties of silicon
Choice D
Describes the occurrence of silicon rather than its chemical properties.
This incorrect about the chemical properties of silicon
55
Sn(s) + dil. 2HCl(aq) → SnC12(aq) + H2(g)
With halogens
Sn(s) + 2C12 → SnC14 in cold media
Ans: A
Ans: B
Ans: D
6. Natural polymers are those that are found in nature. They are obtained from animals and plants. One
example is a natural rubber which is obtained from a rubber tree.
Ans: C
56
7. Biochemistry: studies the chemical substances and reactions that occur in living organisms.
Analytical chemistry: involves identifying, separating. and determining the relative amounts of
components in a material.
Physical chemistry: deals with the relations between the physical properties of a substance and
its chemical composition.
Inorganic chemistry: deals with inorganic compound
Ans: B
8. Significant figures are defined as all digits with a known value and one with an uncertain value.
They also indicate the precision of a measurement.
Ans: D
9. A scientific method is a process of experimentation that is used to seek knowledge and answer
questions
Ans: B
Note: when dividing a number, the least number of significant figures in any number determines
the significant figures in the answer.
13.
Ans: A
14. Nitrogen fixation is a process in which nitrogen gas(N2) is converted into ammonia (NH3)
Ans: C
Ans: C
58
in making lubricants and car polish
in making ceramics and bricks.
Ans: D
17. It is through experimentation, we can prove something is true or not, like in this case checking the
alcohol concentration of a sanitizer
Ans: B
18. Isotopes are atoms with the same number of protons or atomic number but that have a different
number of neutrons.
Ans: B
19. Here is the name of the orbitals of each choice.
A: 3dz2
B. 2pz
C. 3dxy
D. 3dxz
Ans: A
20. Atomic mass = A1f1 + A2f2 + + Anfn
where, Al, A2, A3 are relative masses of each isotope
Ans: D
21. Heisenberg uncertainty states that the position and the momentum(velocity) of a particle cannot
both be measured at the same time.
Ans: D
22. For spontaneous reaction AG < O and EOcell > O
59
For non-spontaneous reaction AG > O and EOceIl 0
Ans: C
24. The electrolysis of copper Sulphate solution using copper electrodes is exactly the same with
platinum(inert) electrodes.
Copper Sulphate solution contains Cu2+, H+ and OH- ions. When a potential difference is
applied across the cathode and anode
Cu2+ and are attracted towards the cathode. Cu2 being lower on the electrochemical series.
it is discharged in preference of H+
OH- and SO4-2 are attracted towards the anode. OH- being lower on the electrochemical
series, it is discharged in preference to SO4-2
At anode = 4OH-(aq) → 2H2O(l) + O2(g) +4e-
At cathode = Cu2+(aq) + 2e-→ Cu(s)
Overall rxn = 2Cu2+(aq) +4OH-(aq) →2Cu(s) +2H2O(l) +O2(g)
During electrolysis of copper sulfate. copper is deposited on the cathode and the same
amount of carbon is dissolved from the anode.
Ans: A
25. faradays first law states the mass of a substance deposited or liberated on an electrode is directly
proportional to the total quantity of electric charge passing through the electrolyte. Its formula is
given by: m = Mlt / nF
m: mass of substance deposited or liberated
M: molar mass of the substance
60
I: current
t: time
n: number of moles of electrons lost or gained
F: Faraday constant
Ans: C
26. Reducing Agent loses or donates an electron to the other reactant, by being itself oxidized.
The more positive the standard reduction potential, the more difficult to oxidize the metal or
easier to be reduced. From this, we can deduce the following among the specified metals:
Cu is the least to oxidize and the easiest to reduce.
K is the most to oxidize, meaning it is the strongest reducing agent.
Ans: B
27. When an electron jumps from a lower energy to a higher energy level. the energy absorbed is equal
to the difference between the two energy levels
Ans: D
28. The electronic configuration of chromium is not
1s22s 22p63s2 3p64s2 3d4 instead it is 1s22s 22p63s2 3p64s1 3d 5
This is because a half-filled 4s subshell and a half-filled 3d subshell give extra stability.
Ans: C
29. Hund's rule states that all orbitals will be singly occupied before any is doubly occupied, and all
electrons in singly orbitals have the same spin (parallel spin).
Ans: B
[ ]
[ ]
A) let’s first find [H3O] eq
CH3COOH(aq) + H2O ↔ H3O+(aq) + CH3COO-
Initial 1 0 0
Change -x +x +x
Equilib. 1 – x x x
1.8 10-5 =
1.8 10-5 = x2
x = [H3O+] eq = 0.0042
32. Due to the presence of common ion (NH4+) in NH4CI, it suppresses the ionization of weak base
NH4OH.
Ans: B
62
In water, at all varying temperatures [H]+ = [OH]- and increase and decrease by the same
amount affecting the value kw. This means it remains neutral with varying temperatures.
Ans: A
37. The octet rule is the tendency of atoms to have eight electrons in the valence shell.
PC15 is an exception to this octet rule.
P, has 5 valence electrons.
Cl, has 7 valence electrons.
Ans: D
38. Covalent compounds have weak intermolecular forces and exist as separate molecules. Because of
this they exist as liquid or gas at room temperature and have low melting and high boiling point.
Ans: D
63
39. CO2 is non-polar because it contains two polar bonds that are arranged symmetrically so that the
two bond dipole moments cancel each other resulting in no dipole moment.
COS is polar because the C=O and C=S bond moments are not equal.
Ans: A
40. The one 2s and three 2P orbitals of carbon are mixed to produce four sp3 orbitals.
Ans: B
43. An acid is a substance that produces more H+ ions in water than OH- ions.
It has a sour taste.
According to Bronsted Lowry, it donates a proton in a chemical reaction
According to Lewis, it accepts a pair of electrons in a chemical reaction.
Ans: C
46. In the formation of NH4+, the fourth hydrogen is attached by a coordinate covalent bond.
Ans: C
64
47. The partially positive hydrogen atom is attracted to the partially negative atom (N, O, or F). For
this reason, it is stronger than ordinary dipole-dipole interaction, this is why compounds like H2O
have a high boiling point.
Ans: A
Ans: D
49. Here is the boiling point and molecular mass of the compounds respectively.
H2S: O and 34g/mol.
H2Se: -41 and 81 g/mol.
H2Te is -2 and 129g/mol.
H2O is 100 and 18g/moI.
So, The boiling point in order is H2S < H2Se < H2Te H2O
Ans: D
50. A homogenous catalyst is a catalyst that exists in the phase as the reactants. In ll. OH(aq) inhibitor
is in the same state as OCl-(aq) and I-(aq).
Note: Inhibitors are called negative catalysts which decrease the rate of reaction.
Ans: B
51. Water is a weak electrolyte because a small fraction of molecules in water dissociate to form H +
and OH- ions. It has a very low ionic product equal to 10-14kw
Ans: C
65
52. HCl + H2O ↔ H3O+ +Cl-
In this reaction, water is acting as a Bronsted Lowery base, it accepts a proton(H+)
NH3 + H2O ↔ NH4+ + OH-
In this reaction, water is acting as a Bronsted Lowery acid, it donates a proton (H+)
Ans: B
Initial 0.25 0 0
Change -x +x +x
Equilib. 0.25 – x x x
6.8 10-4 =
1.7 10-4 = x2
x = [H3O+]eq = 0.013M
B) We can now find the pH of the solution
pH
Ans: B
54. Buffer is a solution that contains either a weak acid and its salt or a weak base and its salt. This
means it is a solution that contains either a weak acid and its conjugate base or a weak base and its
conjugate acid.
Ans: D
55. Catalyst slows down or speeds up a reaction, without itself being consumed.
A positive catalyst increases the rate of a reaction by lowering the activation energy.
A negative catalyst decreases the rate of a reaction by increasing the activation energy.
Ans: D
56. Transition state theory states the collision between two reacting species results in the formation of
an activated complex. An activated complex is a temporary and high energy state. In this complex,
the original bonds are lengthened and weakened, and the new bonds are partially formed.
Ans: B
66
57. A Rate constant (k) is a constant that shows the relationship between the rate of a chemical
reaction and the concentrations of the reacting substances. It indicates how fast/slow a reaction is.
x y
Rate = k[A] [B]
y
k = rate / [AIX [B] ,
Where k is rate constant, A and B are concentrations of A and B.
x and y are the order of reaction
Ans: B
59. By the removing the logarithms of both sides, the equation becomes
-Ea/RT
k = Ae
In the above expression, the symbols represent
k = rate constant at temperature (T)
A= constant
e = 2.303
Ea = activation energy
R = ideal gas constant
From this formula, we understand
reactions with larger activation have smaller reaction constant and therefore slower
for a given value of activation energy, the value of the rate increases as the temperature
increases.
Ans: B
60. "Like dissolves like" means substances with similar chemical characteristics will dissolve each other.
Polar solutes dissolve in polar solvents and non-polar solutes dissolve in non-polar solvents.
C6H6 is soluble in CCl4, they both are non-polar compounds
Ans: A
67
61. Mass percent of solute = (mass of solute / mass of solution) x 100
ppm = (mass of solute / mass of solution) x 106
ppb = (mass of solute / mass of solution) x 109
Ans: D
62. Given: Mass percentage of H2SO4 = 98%
Density of solution = 1.83q /mL
Molar mass of H2SO4 = 98g/mol
Molar mass of Н2О = 18g/mol
Solution: To find Molarity
68
63. Solubility is the maximum amount of a substance that will dissolve in a given amount of solvent at
a given temperature. It is the amount of a substance that gives a saturated solution (maximum
amount of solute dissolved) at a given temperature.
Ans: C
64. According to Lewis definition
Acid is accepting a pair of electrons.
Base is that donates pair of electrons
Ans: D
65. A large equilibrium constant Keg means the reaction proceeds in the forward direction. resulting in
an increase in the concentration of products.
in the opposite direction, resulting in an increase in the concentration of reactants.
Ans: B
66. According to Le Chatelier's Principle, when a system at equilibrium is subjected to stress (such as a
change in concentration, temperature, or pressure), the equilibrium will shift in the direction that
tends to reduce/counter the effect of the stress.
Ans: D
67. The law of mass action states that the rate of a chemical reaction is proportional to the product of
the masses of the reacting substances. with each mass raised to a power equal to the coefficient
that occurs in the chemical equation.
This means
For a reaction aA + bB ↔ cC + dD
Rate of forward reaction α [A]a [B]b
A and B represents the concentration of reactants a and b represent the coefficient of reactions.
Ans: A
69
68. For a reaction, aA + bB ↔ cC + dD
The equilibrium constant will be
[ ] [ ]
[ ] [ ]
When the reactants and products are in gaseous Keq the concentration can be written in
terms of partial pressure and the equilibrium constant is denoted by KP
[ ] [ ]
[ ] [ ]
[ ]
[ ] [ ]
Ans: A
Δn
69. KP = Kc(RT)
Where, Kp: equilibrium constant in terms of atmospheric pressure = 3.8 x 10-3Kp
Kp: equilibrium constant = 3.8 x 10-3kPa = 3.8N/ m2
R: 0.0821 L. atm/mol kelvin = 8.3 Nm/mol Kelvin
T: 2270C = 227 + 273 = 500K
Δn: change in moles number of products-number of moles of reactants = 3- 2=1.
KP = Kc(RT) Δn
Kc = Kp / (RT) Δn
Ans: C
70
70. Solution is a homogenous mixture that doesn’t settle out. e.g., a mixture of salt and water.
Suspension is a heterogeneous mixture in which some of the particles settle out of the
mixture upon standing. e.g. a mixture of sand and water. they will mix upon stirring but
eventually settle
Colloid is also a heterogeneous mixture in which the dispersed particles are intermediate in
size between solution and suspension. Unlike a suspension. they are small enough and
settle down. e.g. clouds are a mixture of air and water
Ans: A
71. Solubility is the maximum amount of a substance that will dissolve in a given amount of solvent at
a given temperature. It is the amount of a substance that gives a saturated solution (maximum
amount of solute dissolved) at a given temperature.
Ans: C
i. Let's find the mass of the dry sodium Mass of dry sodium chloride
= W1— Wo
= 66.2g - 47.5g = 18.7g
Ans: A
aA + bB → cC + dD
Δn = (c+d) — (a+b)
If An 0 like in the formation of NH3, increasing pressure favors the production of a product.
71
Temperature at equilibrium depends on whether the reaction is endothermic or exothermic.
The formation of NH3 is exothermic, it releases energy when the reactants combine.
For exothermic reactions, low temperature favors the production of a product.
Thus, high pressure and low temperature favors the production of NH3
Ans: B
74. In Laboratory. acetic acid is prepared by the oxidation of ethanol with one of these:
Potassium permanganate (KMnO4) or
Potassium dichromate(K2Cr2O7) or
Sodium dichromate (Na2Cr2O7)
Industrially, acetic acid is prepared from the fermentation of ethanol.
Ans: C
75. Ans: A
76.
The 1ongest сагbоn chain contains 5 саrbon atoms each with а single bond. Having СООН
functional groups R is а Pentanoic acid. Counting from right to left, the methyl groups (СН3)
are attached to the 2nd and 3rd саrbоn, R becomes 2.3 — dimethyl pentanoic acid. Final1y. the
chloro group attached to the 4th саrЬоn; it is name becomes 4-ch|oro, 2,3-dimethyl-1 -
pentanoic acid
Ans: C
77. All options are correct except choice D, esters have lower boiling points than carboxylic acids and
alcohols with similar molecular mass.
Ans: D
72
78. Hydrogenation is the process of converting oils to solid fats under high temperature and pressure in
the presence of a catalyst.
Ans: C
79. Acetic acid is produced in the laboratory by the oxidation of ethanol. For this reaction. we can use
ethanol. sodium dichromate, sulphuric acid and carbonate solution to produce acetic acid. Ethanol
will serve as the main reactant and the rest as reagents and catalysts.
Ans: D
80. According to Lewis, a base is any species that donates an electron pair, and an acid is any species
that accepts an electron pair.
The Bronsted-Lowry definition is more general, and considers an acid as a proton donor
and a base as a proton acceptor
AlCl3 is accepts an electron pair.
Cl– is donates an electron pair.
Ans: B
73